Home
Products
7-Ketocholesterol
| Product Name | 7-Ketocholesterol |
| Price: | Inquiry |
| Catalog No.: | CN02276 |
| CAS No.: | 566-28-9 |
| Molecular Formula: | C27H44O2 |
| Molecular Weight: | 400.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | From Cliona copiosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2C(=O)C=C2[C@]1(C)CC[C@@H](C2)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Ketocholesterol, toxic oxysterol, inhibits the rate-limiting step in bile acid biosynthesis cholesterol 7 alpha-hydroxylase, as well as strongly inhibiting HMG-CoA reductase (the rate-limiting enzyme in cholesterol biosynthesis). 7-Ketocholesterol induces cell apoptosis[1]. |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 516.7±29.0 °C at 760 mmHg |
| Flash Point | 218.5±16.9 °C |
| Exact Mass | 400.334137 |
| PSA | 37.30000 |
| LogP | 7.57 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | -20°C |