Home
Products
7Beta-Hydroxycholesterol
| Product Name | 7Beta-Hydroxycholesterol |
| Price: | Inquiry |
| Catalog No.: | CN02437 |
| CAS No.: | 566-27-8 |
| Molecular Formula: | C27H46O2 |
| Molecular Weight: | 402.65 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | From Cliona copiosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2[C@@H](O)C=C2[C@]1(C)CC[C@@H](C2)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7β-Hydroxycholesterol is an oxysterol that derived by the oxidation of cholesterol. 7β-hydroxycholesterol is a powerful inducer of oxidative stress, inducing dysfunction of organelles (mitochondria, lysosomes and peroxisomes) that can cause cell death[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 515.3±38.0 °C at 760 mmHg |
| Flash Point | 214.7±21.4 °C |
| Exact Mass | 402.349792 |
| PSA | 40.46000 |
| LogP | 7.94 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |