Home
Products
Cyclo(Pro-Val)
| Product Name | Cyclo(Pro-Val) |
| Price: | Inquiry |
| Catalog No.: | CN01358 |
| CAS No.: | 5654-87-5 |
| Molecular Formula: | C10H16N2O2 |
| Molecular Weight: | 196.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Penicillium oxalicum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C1NC(=O)C2N(C1=O)CCC2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyclo(Pro-Val) can be isolated from Pseudomonas fluorescens GcM5-1A and has cytotoxicity[1]. |
| Density | 1.17g/cm3 |
| Boiling Point | 420.7ºC at 760 mmHg |
| Flash Point | 208.2ºC |
| Exact Mass | 196.12100 |
| PSA | 49.41000 |
| LogP | 0.39850 |