Home
Products
Sclareolide
| Product Name | Sclareolide |
| Price: | $23 / 20mg |
| Catalog No.: | CN08408 |
| CAS No.: | 564-20-5 |
| Molecular Formula: | C16H26O2 |
| Molecular Weight: | 250.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Perilla frutescens. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C[C@H]2[C@@](O1)(C)CC[C@@H]1[C@]2(C)CCCC1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sclareolide is isolated from the flower of Salvia sclarea with antibacterial and cytotoxic activities[1]. |
| Target | IC50: bacterial[1] |
| In Vitro | Sclareolide has a good antibacterial activity against Staphylococcus aureus ATCC 25923, Pseudomonas aeruginosa ATCC 27950, Escherichia coli ATCC 25922 and Enterococcus faecalis ATCC 29212[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 321.4±10.0 °C at 760 mmHg |
| Flash Point | 132.4±16.4 °C |
| Exact Mass | 250.193283 |
| PSA | 26.30000 |
| LogP | 4.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |