Home
Products
Moracin M
| Product Name | Moracin M |
| Price: | $380 / 5mg |
| Catalog No.: | CN03887 |
| CAS No.: | 56317-21-6 |
| Molecular Formula: | C14H10O4 |
| Molecular Weight: | 242.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)cc(c1)c1oc2c(c1)ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Moracin M, a phenolic component in the skin of Morus alba L., is a potent phosphodiesterase-4 (PDE4) inhibitor with IC50 values of 2.9, 4.5, >40, and >100 μM for PDE4D2, PDE4B2, PDE5A1, and PDE9A2, respectively. Moracin M has anti-inflammatory activity[1]. |
| Target | PDE4D2:2.9 μM (IC50) PDE4B2:4.5 μM (IC50) PDE5A1:>40 μM (IC50) PDE9A2:>100 μM (IC50) Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 369.3±22.0 °C at 760 mmHg |
| Flash Point | 177.1±22.3 °C |
| Exact Mass | 242.057907 |
| PSA | 73.83000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |