Home
Products
Trimethylapigenin
| Product Name | Trimethylapigenin |
| Price: | $62 / 10mg |
| Catalog No.: | CN04583 |
| CAS No.: | 5631-70-9 |
| Molecular Formula: | C18H16O5 |
| Molecular Weight: | 312.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria indica L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7,4'-Trimethoxyflavone is isolated from Kaempferia parviflora (KP) that is a famous medicinal plant from Thailand. 5,7,4'-Trimethoxyflavone induces apoptosis, as evidenced by increments of sub-G1 phase, DNA fragmentation, annexin-V/PI staining, the Bax/Bcl-xL ratio, proteolytic activation of caspase-3, and degradation of poly (ADP-ribose) polymerase (PARP) protein.5,7,4'-Trimethoxyflavone is significantly effective at inhibiting proliferation of SNU-16 human gastric cancer cells in a concentration dependent manner[1]. |
| Target | Caspase-3 PARP |
| Density | 1.242g/cm3 |
| Boiling Point | 506.5ºC at 760mmHg |
| Flash Point | 225.5ºC |
| Exact Mass | 312.10000 |
| PSA | 57.90000 |
| LogP | 3.48580 |