Home
Products
Asperglaucide
| Product Name | Asperglaucide |
| Price: | $366 / 10mg |
| Catalog No.: | CN01771 |
| CAS No.: | 56121-42-7 |
| Molecular Formula: | C27H28N2O4 |
| Molecular Weight: | 444.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Walsura yunnanensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC[C@@H](NC(=O)[C@@H](NC(=O)c1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aurantiamide acetate (TMC-58A) is a selective and orally active cathepsin inhibitor isolated from Portulaca oleracea L. Aurantiamide acetate has anti-inflammatory activities and can be used for the study of inflammatory diseases[1][2]. |
| In Vitro | Aurantiamide acetate inhibits cathepsin L (3.4.22.15) and cathepsin B (3.4.22.1) with IC50 of 12 μM and 49 μM, respectiveiy[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 716.1±60.0 °C at 760 mmHg |
| Flash Point | 386.9±32.9 °C |
| Exact Mass | 444.204895 |
| PSA | 84.50000 |
| LogP | 4.58 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |