Home
Products
Eburicoic acid
| Product Name | Eburicoic acid |
| Price: | $366 / 5mg |
| Catalog No.: | CN07748 |
| CAS No.: | 560-66-7 |
| Molecular Formula: | C31H50O3 |
| Molecular Weight: | 470.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Wolfiporia cocos (Schw.) Ryv. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C(=C)CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eburicoic acid protects the liver from CCl4-induced hepatic damage via antioxidant and anti-inflammatory mechanisms[1]. And Eburicoic acid has antidiabetic and antihyperlipidemic effects[2]. |
| Density | 1.05g/cm3 |
| Boiling Point | 572.6ºC at 760mmHg |
| Flash Point | 314.1ºC |
| Exact Mass | 470.37600 |
| PSA | 57.53000 |
| LogP | 7.78980 |
| Storage condition | 2-8℃ |