Home
Products
L-Cystine
| Product Name | L-Cystine |
| Price: | $12 / 20mg |
| Catalog No.: | CN00670 |
| CAS No.: | 56-89-3 |
| Molecular Formula: | C6H12N2O4S2 |
| Molecular Weight: | 240.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The culture product of Escherichia coli. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NC(C(=O)O)CSSC[C@@H](C(=O)O)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Cystine is an amino acid and intracellular thiol, which plays a critical role in the regulation of cellular processes. |
| Target | Human Endogenous Metabolite |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 468.2±45.0 °C at 760 mmHg |
| Flash Point | 237.0±28.7 °C |
| Exact Mass | 240.023849 |
| PSA | 177.24000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |