Home
Products
Chloramphenicol
| Product Name | Chloramphenicol |
| Price: | $23 / 20mg |
| Catalog No.: | CN00012 |
| CAS No.: | 56-75-7 |
| Molecular Formula: | C11H12Cl2N2O5 |
| Molecular Weight: | 323.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC(C(c1ccc(cc1)[N+](=O)[O-])O)NC(=O)C(Cl)Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chloramphenicol is a broad-spectrum antibiotic.Target: AntibacterialChloramphenicol is a bacteriostatic drug that stops bacterial growth by inhibiting protein synthesis. Chloramphenicol prevents protein chain elongation by inhibiting the peptidyl transferase activity of the bacterial ribosome. It specifically binds to A2451 and A2452 residues in the 23S rRNA of the 50S ribosomal subunit, preventing peptide bond formation. While chloramphenicol and the macrolide class of antibiotics both interact with ribosomes, chloramphenicol is not a macrolide. It directly interferes with substrate binding, whereas macrolides sterically block the progression of the growing peptide [1, 2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 563.2±60.0 °C at 760 mmHg |
| Flash Point | 294.4±32.9 °C |
| Exact Mass | 322.012329 |
| PSA | 115.38000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |