Home
Products
Cantharidin
| Product Name | Cantharidin |
| Price: | Inquiry |
| Catalog No.: | CN09681 |
| CAS No.: | 56-25-7 |
| Molecular Formula: | C10H12O4 |
| Molecular Weight: | 196.20 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The polypides of Mylabris phalerata Pallas |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OC(=O)C2(C1(C)C1CCC2O1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cantharidin, a natural toxin isolated from beetles in the families Meloidae and Oedemeridae, has been reported to be toxic to some pests, including the diamondback moth.IC50 value:Target:In vitro: A 48 h treatment of human erythrocytes with cantharidin significantly increased the percentage of annexin-V-binding cells (≥10 μg/mL), significantly decreased forward scatter (≥25 μg/mL), significantly increased [Ca2+]i (≥25 μg/mL), but did not significantly modify ceramide abundance or ROS [1]. In vivo: |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 326.9±35.0 °C at 760 mmHg |
| Flash Point | 146.1±26.0 °C |
| Exact Mass | 196.073563 |
| PSA | 52.60000 |
| LogP | 0.10 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |