Home
Products
Pseudohypericin
| Product Name | Pseudohypericin |
| Price: | $497 / 10mg |
| Catalog No.: | CN06002 |
| CAS No.: | 55954-61-5 |
| Molecular Formula: | C30H16O9 |
| Molecular Weight: | 520.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Hypericum perforatum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCc1cc(O)c2c3c1c1c(C)cc(c4c1c1c3c3c(C2=O)c(O)cc(c3c2c1c(C4=O)c(O)cc2O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudohypericin and its congener Hypericin are the major hydroxylated phenanthroperylenediones present in Hypericum species. Pseudohypericin shows anti-HIV activity[1][2]. |
| In Vitro | Pseudohypericin shows antiretroviral activity[1]. |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 994.7±65.0 °C at 760 mmHg |
| Flash Point | 569.2±30.8 °C |
| Exact Mass | 520.079407 |
| PSA | 175.75000 |
| LogP | 6.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |