Home
Products
Polyphyllin VI
| Product Name | Polyphyllin VI |
| Price: | $117 / 20mg |
| Catalog No.: | CN02565 |
| CAS No.: | 55916-51-3 |
| Molecular Formula: | C39H62O13 |
| Molecular Weight: | 738.91 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | White cryst. |
| Source: | The rhizomes of Paris yunnanensis Franch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@]3(O)[C@H](C)[C@]3(O4)CC[C@H](CO3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polyphyllin VI, an active saponin mainly isolated from traditional medicinal plant Paris polyphylla, possess anti-cancer activities. Polyphyllin VI induces G2/M cell cycle arrest and triggers apoptosis[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 871.2±65.0 °C at 760 mmHg |
| Flash Point | 480.7±34.3 °C |
| Exact Mass | 738.419067 |
| PSA | 196.99000 |
| LogP | 6.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |