Home
Products
Sclareol glycol
| Product Name | Sclareol glycol |
| Price: | Inquiry |
| Catalog No.: | CN08405 |
| CAS No.: | 55881-96-4 |
| Molecular Formula: | C16H30O2 |
| Molecular Weight: | 254.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The plants of Salvia sclarea L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCCC1C(C)(O)CCC2C1(C)CCCC2(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sclareol glycol is the precursor of ambroxide. Hyphozyma roseonigra ATCC 20624 was the only reported strain capable of degrading sclareol to the main product of sclareol glycol[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 315.3±10.0 °C at 760 mmHg |
| Flash Point | 132.8±13.6 °C |
| Exact Mass | 254.224579 |
| PSA | 40.46000 |
| LogP | 4.13 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |