Home
Products
6-beta-Hydroxyhyoscyamine
| Product Name | 6-beta-Hydroxyhyoscyamine |
| Price: | Inquiry |
| Catalog No.: | CN01735 |
| CAS No.: | 55869-99-3 |
| Molecular Formula: | C17H23NO4 |
| Molecular Weight: | 305.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Anisodus tanguticus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC(c1ccccc1)C(=O)OC1CC2CC(C(C1)N2C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Anisodamine is an anticholinergic and α1-adrenergic receptor antagonist used in the treatment of acute circulatory shock, is also a naturally occurring tropane alkaloid found in some plants of the Solanaceae family. |
| Density | 1.27 |
| Boiling Point | 423.1ºC at 760 mmHg |
| Exact Mass | 305.16300 |
| PSA | 70.00000 |
| LogP | 0.83960 |
| Storage condition | room temp |