Home
Products
Clitorin
| Product Name | Clitorin |
| Price: | $336 / 5mg |
| Catalog No.: | CN04523 |
| CAS No.: | 55804-74-5 |
| Molecular Formula: | C33H40O19 |
| Molecular Weight: | 740.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Clitorin is a kaempferol glycoside isolated from the flowers and leaves of Acalypha indica, and has antioxidant activity[1][2]. |
| Density | 1.74±0.1 g/cm3(Predicted) |
| Boiling Point | 1054.0±65.0 °C(Predicted) |