Home
Products
Crocin 3
| Product Name | Crocin 3 |
| Price: | $467 / 5mg |
| Catalog No.: | CN08186 |
| CAS No.: | 55750-85-1 |
| Molecular Formula: | C32H44O14 |
| Molecular Weight: | 652.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The stigma of Crocus sativus L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C(=O)O)C)C)/C)/C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Crocin III is a crocetin from saffron (Crocus sutivus L.). Crocetins inhibit cell growth of tumor cells and has anti-inflammatory activity. Crocins serve as spices and coloring agents[1][2][3]. |
| Exact Mass | 652.27300 |
| PSA | 232.90000 |