Home
Products
Alliin
| Product Name | Alliin |
| Price: | $103 / 20mg |
| Catalog No.: | CN01041 |
| CAS No.: | 556-27-4 |
| Molecular Formula: | C6H11NO3S |
| Molecular Weight: | 177.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Allium sativum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | N[C@H](C(=O)O)C[S@@](=O)CC=C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alliin, an orally active sulfoxide compound derived from garlic, exhibits hypoglycemic, antioxidant and anti-inflammatory activities[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 416.1±45.0 °C at 760 mmHg |
| Flash Point | 205.5±28.7 °C |
| Exact Mass | 177.045959 |
| PSA | 99.60000 |
| LogP | -0.48 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | −20°C |