Home
Products
Agrimol B
| Product Name | Agrimol B |
| Price: | $125 / 10mg |
| Catalog No.: | CN04064 |
| CAS No.: | 55576-66-4 |
| Molecular Formula: | C37H46O12 |
| Molecular Weight: | 682.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Agrimonia pilosa Ledeb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCCC(=O)c1c(O)c(Cc2c(O)c(Cc3c(O)c(C)c(c(c3O)C(=O)CCC)OC)c(c(c2O)C(=O)C(CC)C)O)c(c(c1OC)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Agrimol B is a polyphenol derived from Agrimonia pilosa Ledeb, suppresses adipogenesis via inducing SIRT1 translocation and expression, and reducing PPARγ expression[1]. |
| Target | SIRT1 PPARγ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 922.6±65.0 °C at 760 mmHg |
| Flash Point | 284.4±27.8 °C |
| Exact Mass | 682.298950 |
| PSA | 211.28000 |
| LogP | 10.45 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20°C |