Home
Products
Mollugin
| Product Name | Mollugin |
| Price: | $37 / 20mg |
| Catalog No.: | CN05902 |
| CAS No.: | 55481-88-4 |
| Molecular Formula: | C17H16O4 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The roots of Rubia cordifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1c2C=CC(Oc2c2c(c1O)cccc2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mollugin is a major bioactive component isolated from Rubia cordifolia L.. Mollugin has an anti-cancer therapeutic effect by inhibiting TNF-α-induced NF-κB activation. Mollugin enhances the osteogenic action of BMP-2 via the p38-Smad signaling pathway [1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 453.2±45.0 °C at 760 mmHg |
| Flash Point | 167.5±22.2 °C |
| Exact Mass | 284.104858 |
| PSA | 55.76000 |
| LogP | 5.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |