Home
Products
Hibifolin
| Product Name | Hibifolin |
| Price: | $234 / 10mg |
| Catalog No.: | CN04328 |
| CAS No.: | 55366-56-8 |
| Molecular Formula: | C21H18O14 |
| Molecular Weight: | 494.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Abelmoschus manihot |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1C(O)C(OC(C1O)C(=O)O)Oc1c(O)cc(c2c1oc(c1ccc(c(c1)O)O)c(c2=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hibifolin, a flavonol glycoside, is a potential inhibitor of adenosine deaminase (ADA), with a Ki of 49.92 μM. Hibifolin protects neurons against beta-amyloid-induced neurotoxicity[1][2]. |
| Target | Ki: 49.92 μM (ADA)[1] |
| Exact Mass | 494.07000 |
| PSA | 247.81000 |
| Storage condition | 2-8℃ |