Home
Products
Atherosperminine
| Product Name | Atherosperminine |
| Price: | $263 / 10mg |
| Catalog No.: | CN00783 |
| CAS No.: | 5531-98-6 |
| Molecular Formula: | C20H23NO2 |
| Molecular Weight: | 309.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Fissistigma glaucescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CCN(C)C)c2c(c1OC)c1ccccc1cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atherosperminine（Atherospermine）is a nature occurring alkaloid, has antiplasmodial activities in vitro, with an IC50 of 5.80 μM. Atherosperminine is good reductants with the ability to chelate metals and presented pro-oxidant activity. Atherosperminine exerts a non-specific relaxant effect on the trachealis[1]. |
| Target | IC50: 5.80 μM (P. falciparum, K1 strain)[1] |
| Density | 1.109g/cm3 |
| Boiling Point | 466.1ºC at 760mmHg |
| Flash Point | 161.5ºC |
| Exact Mass | 309.17300 |
| PSA | 21.70000 |
| LogP | 4.11430 |
| Storage condition | 2-8℃ |