Home
Products
Xanthyletin
| Product Name | Xanthyletin |
| Price: | Inquiry |
| Catalog No.: | CN06125 |
| CAS No.: | 553-19-5 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus chachiensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1(C)C=Cc2c(O1)cc1c(c2)ccc(=O)o1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthyletin is a coumarin isolated from Citrus, with anti-tumor and anti-bacterial activities. Xanthyletin also inhibits symbiotic fungus cultivated by leaf-cutting ants[1]. |
| Target | Fugal[1][2] |
| In Vitro | Xanthyletin inhibits symbiotic fungus cultivated by leaf-cutting ants[1]. Xanthyletin (25, 50, and 100 µg/mL) shows a total inhibition on the fungus[2]. |
| Density | 1.222g/cm3 |
| Boiling Point | 384.6ºC at 760mmHg |
| Flash Point | 161.9ºC |
| Exact Mass | 228.07900 |
| PSA | 39.44000 |
| LogP | 2.97720 |