Home
Products
Daidzin
| Product Name | Daidzin |
| Price: | $23 / 20mg |
| Catalog No.: | CN05561 |
| CAS No.: | 552-66-9 |
| Molecular Formula: | C21H20O9 |
| Molecular Weight: | 416.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2ccc3c(c2)occ(c3=O)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Daidzin is an isoflavone that has anti-oxidant, anti-carcinogenic, and anti-atherosclerotic activities; directly inhibits mitochondrial aldehyde dehydrogenase 2 (IC50 = 80 nM) and is an effective anti-dipsotropic isoflavone. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 727.6±60.0 °C at 760 mmHg |
| Flash Point | 259.8±26.4 °C |
| Exact Mass | 416.110718 |
| PSA | 149.82000 |
| LogP | 0.45 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |