Home
Products
Prunetin
| Product Name | Prunetin |
| Price: | $146 / 10mg |
| Catalog No.: | CN05224 |
| CAS No.: | 552-59-0 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Millettia dielsiana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)occ(c2=O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Prunetin, an O-methylated isoflavone, possesses anti-inflammatory activity. Prunetin is a potent human aldehyde dehydrogenases inhibitor[1][2]. |
| In Vitro | Prunetin inhibited LPS-induced inflammatory cytokine production and MUC5 AC expression and secretion by inactivating the TLR4/MyD88 pathway in human nasal epithelial cells[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 546.5±50.0 °C at 760 mmHg |
| Flash Point | 209.7±23.6 °C |
| Exact Mass | 284.068481 |
| PSA | 79.90000 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |