Home
Products
Isorhoifolin
| Product Name | Isorhoifolin |
| Price: | $190 / 5mg |
| Catalog No.: | CN05298 |
| CAS No.: | 552-57-8 |
| Molecular Formula: | C27H30O14 |
| Molecular Weight: | 578.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Citrus paradisi. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@@H](O[C@@H]([C@H]([C@@H]1O)O)CO[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)Oc1cc(O)c2c(c1)oc(cc2=O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorhoifolin is a flavonoid glycoside from periploca nigrescens leaves. Isorhoifolin displays an anti-leakage effect[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 912.7±65.0 °C at 760 mmHg |
| Flash Point | 304.2±27.8 °C |
| Exact Mass | 578.163574 |
| PSA | 228.97000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |