Home
Products
Liquiritin
| Product Name | Liquiritin |
| Price: | $46 / 20mg |
| Catalog No.: | CN05544 |
| CAS No.: | 551-15-5 |
| Molecular Formula: | C21H22O9 |
| Molecular Weight: | 418.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)[C@@H]2CC(=O)c3c(O2)cc(cc3)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Liquiritin is a flavonoid isolated from Glycyrrhiza, acts as an antioxidant and has neuroprotective, anti-cancer and anti-inflammatory activity[1][2]. |
| Target | Liquiritin (100 µM) increases glucose-6-phosphate dehydrogenase expression on B65 neuroblastoma cells[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 746.8±60.0 °C at 760 mmHg |
| Flash Point | 265.9±26.4 °C |
| Exact Mass | 418.126373 |
| PSA | 145.91000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | 2-8°C |