Home
Products
Isorhamnetin-3-O-neohespeidoside
| Product Name | Isorhamnetin-3-O-neohespeidoside |
| Price: | $92 / 20mg |
| Catalog No.: | CN05494 |
| CAS No.: | 55033-90-4 |
| Molecular Formula: | C28H32O16 |
| Molecular Weight: | 624.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Rhamnus purshiana |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorhamnetin-3-O-neohespeidoside is a flavonoid isolated from Pollen typhae[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 956.8±65.0 °C at 760 mmHg |
| Flash Point | 314.2±27.8 °C |
| Exact Mass | 624.169006 |
| PSA | 258.43000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |