Home
Products
3,3'',5-Triiodo-L-thyronine Sodium Salt
| Product Name | 3,3'',5-Triiodo-L-thyronine Sodium Salt |
| Price: | Inquiry |
| Catalog No.: | CN01969 |
| CAS No.: | 55-06-1 |
| Molecular Formula: | C15H11I3NNaO4 |
| Molecular Weight: | 672.96 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | [O-]C(=O)[C@H](Cc1cc(I)c(c(c1)I)Oc1ccc(c(c1)I)O)N.[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,3',5-Triiodo-L-thyronine sodium is an active form of thyroid hormone, which binds to β1 thyroid hormone receptor (TRβ1), and activates its activity. |
| Target | TRβ1[1][2] |
| In Vitro | 3,3',5-Triiodo-L-thyronine (T3, 100 nM) stimulates the proliferation of hepatocarcinema cells in which TRβ1 is overexpressed[1]. 3,3',5-Triiodo-L-thyronine binds to human β1 thyroid hormone receptor (hTRβ1), and change its conformation. 3,3',5-Triiodo-L-thyronine promotes growth, induces differentiation and regualtes metabolic effects[2]. |
| Cell Assay | Thyroid hormone depleted (Td) serum is prepared. The growth of hepatocarcinoma cells in methylcellulose is performed. To determine the effect of 3,3',5-Triiodo-L-thyronine (T3) on the growth of cells, cells are plated at a density of 3 × 104 cells/60 mm dish on day 0, and incubated in medium containing 5% regular serum, 5% Td or 5% Td and 100 nM T3. The colony formation in methylcellulose is scored 3 weeks after initial plating[1]. |
| Boiling Point | 563.5ºC at 760 mmHg |
| Flash Point | 294.6ºC |
| Exact Mass | 672.771973 |
| PSA | 95.61000 |
| LogP | 3.31830 |