Home
Products
8-Oxyberberine
| Product Name | 8-Oxyberberine |
| Price: | $117 / 20mg |
| Catalog No.: | CN01266 |
| CAS No.: | 549-21-3 |
| Molecular Formula: | C20H17NO5 |
| Molecular Weight: | 351.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Mahonia japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1c(=O)n1c(c2)c2cc3OCOc3cc2CC1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Berlambine is a natural alkaloid isolated from many plants[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 611.5±55.0 °C at 760 mmHg |
| Flash Point | 323.6±31.5 °C |
| Exact Mass | 351.110687 |
| PSA | 58.92000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |