Home
Products
Pinobanksin
| Product Name | Pinobanksin |
| Price: | $409 / 5mg |
| Catalog No.: | CN05300 |
| CAS No.: | 548-82-3 |
| Molecular Formula: | C15H12O5 |
| Molecular Weight: | 272.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The barks of Pinus koraiensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2O[C@H](c3ccccc3)[C@H](C(=O)c2c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinobanksin has apoptotic induction in a B-cell lymphoma cell line[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 570.6±50.0 °C at 760 mmHg |
| Flash Point | 222.0±23.6 °C |
| Exact Mass | 272.068481 |
| PSA | 86.99000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |