Home
Products
Quercetagetin-7-O-glucoside
| Product Name | Quercetagetin-7-O-glucoside |
| Price: | $146 / 10mg |
| Catalog No.: | CN04799 |
| CAS No.: | 548-75-4 |
| Molecular Formula: | C21H20O13 |
| Molecular Weight: | 480.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Tagetes erecta L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc3oc(c4ccc(c(c4)O)O)c(c(=O)c3c(c2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetagitrin (Quercetagetin-7-O-glucoside), isolated from the flowers of the African Marigold (Tagetes erecta), has anti-inflammatory activity[1][2]. |
| Density | 1.883g/cm3 |
| Boiling Point | 908ºC at 760mmHg |
| Flash Point | 318.3ºC |
| Exact Mass | 480.09000 |
| PSA | 230.74000 |