Home
Products
Cornin
| Product Name | Cornin |
| Price: | $92 / 20mg |
| Catalog No.: | CN03157 |
| CAS No.: | 548-37-8 |
| Molecular Formula: | C17H24O10 |
| Molecular Weight: | 388.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Cornus officinalis Sieb. et Zucc. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@H](C)CC3=O)C(=O)OC)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Verbenalin is Verbena glycoside, with anti-inflammatory, anti-fungal anti-virus activities. Verbenalin has a good effect on prostatitis. Verbenalin can reduce cerebral ischemia-reperfusion injury[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 610.1±55.0 °C at 760 mmHg |
| Flash Point | 219.4±25.0 °C |
| Exact Mass | 388.136932 |
| PSA | 151.98000 |
| LogP | -2.39 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Storage condition | 2-8C |