Home
Products
Hypericin
| Product Name | Hypericin |
| Price: | $143 / 20mg |
| Catalog No.: | CN06004 |
| CAS No.: | 548-04-9 |
| Molecular Formula: | C30H16O8 |
| Molecular Weight: | 504.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Hypericum perforatum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(C)c2c3c1C(=O)c1c(O)cc(c4c1c3c1c3c2c(C)cc(c3C(=O)c2c1c4c(O)cc2O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypericin is a photosensitive antiviral with anticancer and antidepressant agent derived from Hypericum perforatum. It can inhibit tyrosine kinases with IC50 of 7.5 μM. IC50: 7.5 uMIn vitro:The photosensitive of hypericin can induce both apoptosis and necrosis in a concentration and light dose-dependent fashion. PDT with hypericin results in the activation of multiple pathways that can either promote or counteract the cell death program. It can effect cytotoxic to tumor cells by visible light. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 930.1±65.0 °C at 760 mmHg |
| Flash Point | 530.1±30.8 °C |
| Exact Mass | 504.084503 |
| PSA | 155.52000 |
| LogP | 8.39 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | Store at +4°C |