Home
Products
20-Deoxyingenol
| Product Name | 20-Deoxyingenol |
| Price: | Inquiry |
| Catalog No.: | CN08553 |
| CAS No.: | 54706-99-9 |
| Molecular Formula: | C20H28O4 |
| Molecular Weight: | 332.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@H]2[C@H]3[C@H](C3(C)C)C[C@H]([C@]3([C@@]([C@@H]1O)(O)[C@@H](O)C(=C3)C)C2=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20-Deoxyingenol is a natural compound. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 470.5±45.0 °C at 760 mmHg |
| Flash Point | 252.4±25.2 °C |
| Exact Mass | 332.198761 |
| PSA | 77.76000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | -20°C |