Home
Products
2-(Acetylamino)-3-phenyl-2-propenoic acid
| Product Name | 2-(Acetylamino)-3-phenyl-2-propenoic acid |
| Price: | Inquiry |
| Catalog No.: | CN02063 |
| CAS No.: | 5469-45-4 |
| Molecular Formula: | C11H11NO3 |
| Molecular Weight: | 205.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White cryst. |
| Source: | The barks of Cinnamomum cassia Presl |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)/C=C/c1ccccc1NC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 455.4±45.0 °C at 760 mmHg |
| Flash Point | 229.2±28.7 °C |
| Exact Mass | 205.073898 |
| PSA | 66.40000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |