Home
Products
Conessine
| Product Name | Conessine |
| Price: | Inquiry |
| Catalog No.: | CN00586 |
| CAS No.: | 546-06-5 |
| Molecular Formula: | C24H40N2 |
| Molecular Weight: | 356.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Holarrbena antidysenterica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN([C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]24[C@H]3CC[C@@H]4[C@@H](N(C2)C)C)C1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Conessine, a steroidal alkaloid, is a potent and selective histamine H3 receptor antagonist with Kis of 5.4, 6.0, 5.7 and 25 nM for human, dog, guinea pig, and rat H H3 receptor, respectively. Anti-malarial activity[1]. |
| Target | H3 Receptor:5.4 nM (Ki) rat H3 receptor:25 nM (Ki) Guinea pig H3 Receptor:6.0 nM (Ki) Dog H3 Receptor:5.7 nM (Ki) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 450.4±45.0 °C at 760 mmHg |
| Flash Point | 199.6±16.5 °C |
| Exact Mass | 356.319153 |
| PSA | 6.48000 |
| LogP | 5.71 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |