Home
Products
6-Hydroxyluteolin 7-glucoside
| Product Name | 6-Hydroxyluteolin 7-glucoside |
| Price: | $219 / 5mg |
| Catalog No.: | CN04464 |
| CAS No.: | 54300-65-1 |
| Molecular Formula: | C21H20O12 |
| Molecular Weight: | 464.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Saluia plebeia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3oc(cc(=O)c3c(c2O)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Hydroxyluteolin 7-glucoside is a flavonoid from Tanacetum parthenium and T. vulgare. 6-Hydroxyluteolin 7-glucoside inhibits the major pathways of arachidonate metabolism in leukocytes. 6-Hydroxyluteolin 7-glucoside has anti-inflammatory effect[1]. |
| Exact Mass | 464.09500 |
| PSA | 210.51000 |
| Storage condition | 2-8℃ |