Home
Products
13-Methylberberine
| Product Name | 13-Methylberberine |
| Price: | $293 / 10mg |
| Catalog No.: | CN00769 |
| CAS No.: | 54260-72-9 |
| Molecular Formula: | C21H20ClNO4 |
| Molecular Weight: | 385.84 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Corydalis longipes. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1c[n+]1CCc3c(c1c2C)cc1c(c3)OCO1.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 13-Methylberberine chloride (13-Methylberberinium chloride), a berberine analogue, has anti-adipogenic and antitumor activities. 13-Methylberberine chloride (13-Methylberberinium chloride) increases production of IL-12 and inhibits the expression of iNOS at posttranscriptional level in macrophages activated with LPS[1][2][3]. |
| Exact Mass | 385.10800 |
| PSA | 40.80000 |
| LogP | 0.40870 |
| Storage condition | 2-8℃ |