Home
Products
Neoisoastilbin
| Product Name | Neoisoastilbin |
| Price: | $169 / 10mg |
| Catalog No.: | CN04789 |
| CAS No.: | 54141-72-9 |
| Molecular Formula: | C21H22O11 |
| Molecular Weight: | 450.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Simlax glabra Roxb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)OC(C(C2=O)OC1OC(C)C(C(C1O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoisoastilbin possesses antioxidant, anti-hyperuricemic and anti-Inflammatory activities[1]. |
| Density | 1.74g/cm3 |
| Boiling Point | 801.1ºC at 760mmHg |
| Flash Point | 282.9ºC |
| Exact Mass | 450.11600 |
| PSA | 186.37000 |
| LogP | 0.03810 |
| Storage condition | 2-8℃ |