Home
Products
Isoastilbin
| Product Name | Isoastilbin |
| Price: | $176 / 10mg |
| Catalog No.: | CN05302 |
| CAS No.: | 54081-48-0 |
| Molecular Formula: | C21H22O11 |
| Molecular Weight: | 450.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Simlax glabra Roxb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)O[C@H]([C@@H](C2=O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoastilbin is a dihydroflavonol glycoside compound in Rhizoma Smilacis glabrae and Astragalus membranaceus. Isoastilbin inhibits glucosyltransferase (GTase) with an IC50 value of 54.3 μg/mL, and also inhibits tyrosinase activity. Isoastilbin shows neuroprotective, antioxidation, antimicrobial and anti-apoptotic properties and has the potential for Alzheimer’s disease research[1][21][3]. |
| Target | IC50: 54.3 μg/mL (Glucosyltransferase (GTase)[2] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 801.1±65.0 °C at 760 mmHg |
| Flash Point | 282.9±27.8 °C |
| Exact Mass | 450.116211 |
| PSA | 186.37000 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |