Home
Products
(+)-gamma-Tocopherol
| Product Name | (+)-gamma-Tocopherol |
| Price: | Inquiry |
| Catalog No.: | CN03284 |
| CAS No.: | 54-28-4 |
| Molecular Formula: | C28H48O2 |
| Molecular Weight: | 416.7 g/mol |
| Purity: | >95% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The seeds of Sunflower. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@H](CCC[C@@H](CCCC(C)C)C)CCC[C@@]1(C)CCc2c(O1)c(C)c(c(c2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | γ-Tocopherol (D-γ-Tocopherol) is a potent cyclooxygenase (COX) inhibitor. γ-Tocopherol is a naturally occurring form of Vitamin E in many plant seeds, such as corn oil and soybeans. γ-Tocopherol possesses antiinflammatory properties and anti-cancer activity[1]. |
| Target | Cyclooxygenase |
| In Vitro | γ-Tocopherol (D-γ-Tocopherol) is well absorbed and accumulates to a significant degree in some human tissues; it is metabolized, however, largely to 2,7,8-trimethyl-2-(beta-carboxyethyl)-6-hydroxychroman (gamma-CEHC), which is mainly excreted in the urine[1]. Plasma concentrations of γ-Tocopherol (D-γ-Tocopherol) are inversely associated with the incidence of cardiovascular disease and prostate cancer[1]. |
| Density | 0.933g/cm3 |
| Boiling Point | 200 °C (0.1 mmHg) |
| Flash Point | 206ºC |
| Exact Mass | 416.36500 |
| PSA | 29.46000 |
| LogP | 8.53180 |
| Storage condition | 2~8°C |