Home
Products
Tryptophan
| Product Name | Tryptophan |
| Price: | Inquiry |
| Catalog No.: | CN01283 |
| CAS No.: | 54-12-6 |
| Molecular Formula: | C11H12N2O2 |
| Molecular Weight: | 204.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The seeds of Glycine max |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)C(Cc1c[nH]c2c1cccc2)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | DL-Tryptophan is an endogenous metabolite. |
| Target | Human Endogenous Metabolite |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 447.9±35.0 °C at 760 mmHg |
| Flash Point | 224.7±25.9 °C |
| Exact Mass | 204.089874 |
| PSA | 79.11000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | Store at RT. |