Home
Products
Aristolactam BII
| Product Name | Aristolactam BII |
| Price: | Inquiry |
| Catalog No.: | CN01830 |
| CAS No.: | 53948-09-7 |
| Molecular Formula: | C17H13NO3 |
| Molecular Weight: | 279.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Aristolochia debilis Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c3c1c1ccccc1cc3[nH]c2=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cepharanone B is a fluorescent component isolated from the callus tissue of stephania cephaiuntha[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 429.7±38.0 °C at 760 mmHg |
| Flash Point | 213.7±26.8 °C |
| Exact Mass | 279.089539 |
| PSA | 51.32000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |