Home
Products
Corylin
| Product Name | Corylin |
| Price: | $80 / 20mg |
| Catalog No.: | CN05303 |
| CAS No.: | 53947-92-5 |
| Molecular Formula: | C20H16O4 |
| Molecular Weight: | 320.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Psoraela corylifolia. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)occ(c2=O)c1ccc2c(c1)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corylin is a major bioactive compound isolated from Psoralea corylifolia L; antibiotic or anticancer compound.IC50 value:Target: in vitro: Corylin showed an inhibitory effect on IL-6-induced STAT3 promoter activity in Hep3B cells with IC50 value of 1.37 uM [1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 527.4±50.0 °C at 760 mmHg |
| Flash Point | 193.1±23.6 °C |
| Exact Mass | 320.104858 |
| PSA | 59.67000 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |