Home
Products
Hederagenin 28-O-beta-D-glucopyranosyl ester
| Product Name | Hederagenin 28-O-beta-D-glucopyranosyl ester |
| Price: | $277 / 10mg |
| Catalog No.: | CN07565 |
| CAS No.: | 53931-25-2 |
| Molecular Formula: | C36H58O9 |
| Molecular Weight: | 634.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedera nepalensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@@]23CCC(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H]([C@@]2(C)CO)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hederagenin 28-O-beta-D-glucopyranosyl ester, a triterpenoid saponin isolated from Ilex cornuta, exhibits protective effects against H2O2-induced myocardial cell injury[1]. |
| Density | 1.27±0.1 g/cm3 |
| Boiling Point | 729.7±60.0 °C at 760 mmHg |
| Flash Point | 220.2±26.4 °C |
| Exact Mass | 634.408081 |
| PSA | 156.91000 |
| LogP | 6.68 |
| Vapour Pressure | 0.0±5.4 mmHg at 25°C |