Home
Products
1,2,3-Tri-n-Octanoylglycerol
| Product Name | 1,2,3-Tri-n-Octanoylglycerol |
| Price: | Inquiry |
| Catalog No.: | CN06433 |
| CAS No.: | 538-23-8 |
| Molecular Formula: | C27H50O6 |
| Molecular Weight: | 470.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCC(=O)OC(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tricaprilin (Trioctanoin) is used in study for patients with mild to moderate Alzheimer's disease and has a role as an anticonvulsant and a plant metabolite[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 508.0±17.0 °C at 760 mmHg |
| Flash Point | 209.3±21.0 °C |
| Exact Mass | 470.360748 |
| PSA | 78.90000 |
| LogP | 9.33 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |