Home
Products
CP-724714
| Product Name | CP-724714 |
| Price: | Inquiry |
| Catalog No.: | CN00111 |
| CAS No.: | 537705-08-1 |
| Molecular Formula: | C27H27N5O3 |
| Molecular Weight: | 469.53 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)NC/C=C/c1ccc2c(c1)c(ncn2)Nc1ccc(c(c1)C)Oc1ccc(nc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (E/Z)-CP-724714 is a racemic compound of (E)-CP-724714 and (Z)-CP-724714 isomers. CP-724714 is a potent and selective orally active ErbB2 (HER2) inhibitor[1]. |
| Target | HER2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 687.3±55.0 °C at 760 mmHg |
| Flash Point | 369.5±31.5 °C |
| Exact Mass | 469.211395 |
| PSA | 98.26000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | -20°C |