Home
Products
Luteolin-7-O-glucoside
| Product Name | Luteolin-7-O-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN05377 |
| CAS No.: | 5373-11-5 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Dracocephalum ruyschiana L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cynaroside is a flavone, a flavonoid-like chemical compound. It is a 7-O-glucoside of luteolin. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 838.1±65.0 °C at 760 mmHg |
| Flash Point | 296.8±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | -0.09 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8°C |