Home
Products
Bruceantinol
| Product Name | Bruceantinol |
| Price: | Inquiry |
| Catalog No.: | CN08322 |
| CAS No.: | 53729-52-5 |
| Molecular Formula: | C30H38O13 |
| Molecular Weight: | 606.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Brucea javanica (L.) Merr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)[C@@]12OC[C@]34[C@H]2[C@@H](OC(=O)/C=C(/C(OC(=O)C)(C)C)C)C(=O)O[C@@H]4C[C@@H]2[C@]([C@H]3[C@H]([C@@H]1O)O)(C)CC(=O)C(=C2C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bruceantinol (compound 4) is a quassinoid compound isolated from the CH3OH extract of Brucea javanica. Bruceantinol exhibits inactivation effects in systemic host plants. Bruceantinol is potent, with a minimum inhibitory concentration of 10 μM[1]. |
| Exact Mass | 606.23100 |
| PSA | 192.19000 |
| LogP | 0.83880 |